C15H23NO2S — CID 125131294
(2S)-1-[(2R,6R)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]hex-5-en-2-ol (PubChem CID 125131294) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is (2S)-1-[(2R,6R)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]hex-5-en-2-ol.
| Compound Name | (2S)-1-[(2R,6R)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]hex-5-en-2-ol |
|---|---|
| PubChem CID | 125131294 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (2S)-1-[(2R,6R)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]hex-5-en-2-ol |
| SMILES | C=CCC[C@H](O)CN1C[C@@H](C)O[C@H](c2ccsc2)C1 |
| InChI | InChI=1S/C15H23NO2S/c1-3-4-5-14(17)9-16-8-12(2)18-15(10-16)13-6-7-19-11-13/h3,6-7,11-12,14-15,17H,1,4-5,8-10H2,2H3/t12-,14+,15+/m1/s1 |
| InChIKey | DOPMHGXLZZRMDP-SNPRPXQTSA-N |
| XLogP | 2.84 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|