C18H31NO2 — CID 124729687
1-[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-[(1S,2R)-2-methylcyclohexyl]oxyethanone (PubChem CID 124729687) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 1-[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-[(1S,2R)-2-methylcyclohexyl]oxyethanone.
| Compound Name | 1-[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-[(1S,2R)-2-methylcyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 124729687 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 1-[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-[(1S,2R)-2-methylcyclohexyl]oxyethanone |
| SMILES | C[C@@H]1CCCC[C@@H]1OCC(=O)N1[C@H](C)C[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C18H31NO2/c1-13-7-3-6-10-17(13)21-12-18(20)19-14(2)11-15-8-4-5-9-16(15)19/h13-17H,3-12H2,1-2H3/t13-,14-,15-,16-,17+/m1/s1 |
| InChIKey | GOQOGUJRLNXIPV-HHARLNAUSA-N |
| XLogP | 3.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |