C20H20N4O2 — CID 124729838
N-[4-(4-methyl-1,2,4-triazol-3-yl)phenyl]-3-[(3R)-oxolan-3-yl]benzamide (PubChem CID 124729838) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is N-[4-(4-methyl-1,2,4-triazol-3-yl)phenyl]-3-[(3R)-oxolan-3-yl]benzamide.
| Compound Name | N-[4-(4-methyl-1,2,4-triazol-3-yl)phenyl]-3-[(3R)-oxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 124729838 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[4-(4-methyl-1,2,4-triazol-3-yl)phenyl]-3-[(3R)-oxolan-3-yl]benzamide |
| SMILES | Cn1cnnc1-c1ccc(NC(=O)c2cccc([C@H]3CCOC3)c2)cc1 |
| InChI | InChI=1S/C20H20N4O2/c1-24-13-21-23-19(24)14-5-7-18(8-6-14)22-20(25)16-4-2-3-15(11-16)17-9-10-26-12-17/h2-8,11,13,17H,9-10,12H2,1H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | GTURPRKOQJVNJZ-KRWDZBQOSA-N |
| XLogP | 3.24 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |