C14H11IN4OS — CID 78949881
5-iodo-N-[4-(4-methyl-1,2,4-triazol-3-yl)phenyl]thiophene-3-carboxamide (PubChem CID 78949881) has the molecular formula C14H11IN4OS and a molecular weight of 410.24 g/mol. Its IUPAC name is 5-iodo-N-[4-(4-methyl-1,2,4-triazol-3-yl)phenyl]thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-[4-(4-methyl-1,2,4-triazol-3-yl)phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 78949881 |
| Molecular Formula | C14H11IN4OS |
| Molecular Weight | 410.24 g/mol |
| Exact Mass | 409.97 |
| IUPAC Name | 5-iodo-N-[4-(4-methyl-1,2,4-triazol-3-yl)phenyl]thiophene-3-carboxamide |
| SMILES | Cn1cnnc1-c1ccc(NC(=O)c2csc(I)c2)cc1 |
| InChI | InChI=1S/C14H11IN4OS/c1-19-8-16-18-13(19)9-2-4-11(5-3-9)17-14(20)10-6-12(15)21-7-10/h2-8H,1H3,(H,17,20) |
| InChIKey | SDTCUPBFXSGZMD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|