C15H23NOS2 — CID 124731801
(1R,6R)-4-(2-benzylsulfanylethyl)-6-methyl-1,4-thiazepane 1-oxide (PubChem CID 124731801) has the molecular formula C15H23NOS2 and a molecular weight of 297.49 g/mol. Its IUPAC name is (1R,6R)-4-(2-benzylsulfanylethyl)-6-methyl-1,4-thiazepane 1-oxide.
| Compound Name | (1R,6R)-4-(2-benzylsulfanylethyl)-6-methyl-1,4-thiazepane 1-oxide |
|---|---|
| PubChem CID | 124731801 |
| Molecular Formula | C15H23NOS2 |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (1R,6R)-4-(2-benzylsulfanylethyl)-6-methyl-1,4-thiazepane 1-oxide |
| SMILES | C[C@@H]1CN(CCSCc2ccccc2)CC[S@](=O)C1 |
| InChI | InChI=1S/C15H23NOS2/c1-14-11-16(8-10-19(17)13-14)7-9-18-12-15-5-3-2-4-6-15/h2-6,14H,7-13H2,1H3/t14-,19+/m1/s1 |
| InChIKey | JEELDIIOOVRKBY-KUHUBIRLSA-N |
| XLogP | 2.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|