C18H28N2O2S — CID 122043489
2-[[1-(2-benzylsulfanylethyl)azepan-4-yl]-methylamino]acetic acid (PubChem CID 122043489) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is 2-[[1-(2-benzylsulfanylethyl)azepan-4-yl]-methylamino]acetic acid.
| Compound Name | 2-[[1-(2-benzylsulfanylethyl)azepan-4-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 122043489 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 2-[[1-(2-benzylsulfanylethyl)azepan-4-yl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C1CCCN(CCSCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H28N2O2S/c1-19(14-18(21)22)17-8-5-10-20(11-9-17)12-13-23-15-16-6-3-2-4-7-16/h2-4,6-7,17H,5,8-15H2,1H3,(H,21,22) |
| InChIKey | PSQAAUXPNHNWLL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|