About 1-ethoxy-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]cyclopentane-1-carboxamide
1-ethoxy-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]cyclopentane-1-carboxamide (PubChem CID 124732651) has the molecular formula C14H25NO3
and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-ethoxy-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]cyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | 1-ethoxy-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]cyclopentane-1-carboxamide |
| PubChem CID | 124732651 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 1-ethoxy-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]cyclopentane-1-carboxamide |
| SMILES | CCOC1(C(=O)NC[C@@H]2CCC[C@H]2O)CCCC1 |
| InChI | InChI=1S/C14H25NO3/c1-2-18-14(8-3-4-9-14)13(17)15-10-11-6-5-7-12(11)16/h11-12,16H,2-10H2,1H3,(H,15,17)/t11-,12+/m0/s1 |
| InChIKey | JTZTVZLCYROJJM-NWDGAFQWSA-N |
| XLogP | 1.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethoxy-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]cyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]cyclopentane-1-carboxamide?
The IUPAC name of 1-ethoxy-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]cyclopentane-1-carboxamide (CID 124732651) is 1-ethoxy-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]cyclopentane-1-carboxamide.
What is the SMILES notation for 1-ethoxy-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]cyclopentane-1-carboxamide?
The canonical SMILES for 1-ethoxy-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]cyclopentane-1-carboxamide is CCOC1(C(=O)NC[C@@H]2CCC[C@H]2O)CCCC1.
What is the InChIKey of 1-ethoxy-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]cyclopentane-1-carboxamide?
The InChIKey is JTZTVZLCYROJJM-NWDGAFQWSA-N. The full InChI is InChI=1S/C14H25NO3/c1-2-18-14(8-3-4-9-14)13(17)15-10-11-6-5-7-12(11)16/h11-12,16H,2-10H2,1H3,(H,15,17)/t11-,12+/m0/s1.
What are the key properties of 1-ethoxy-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]cyclopentane-1-carboxamide?
1-ethoxy-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]cyclopentane-1-carboxamide has a molecular weight of 255.36 g/mol, XLogP of 1.61, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]cyclopentane-1-carboxamide is sourced from PubChem (CID 124732651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).