C24H34N4O3S — CID 124733592
ethyl 4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-methyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 124733592) has the molecular formula C24H34N4O3S and a molecular weight of 458.63 g/mol. Its IUPAC name is ethyl 4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-methyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-methyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 124733592 |
| Molecular Formula | C24H34N4O3S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | ethyl 4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-methyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1sc2nc(CN3CCOCC3)nc(N3CC[C@H]4CCCC[C@H]4C3)c2c1C |
| InChI | InChI=1S/C24H34N4O3S/c1-3-31-24(29)21-16(2)20-22(28-9-8-17-6-4-5-7-18(17)14-28)25-19(26-23(20)32-21)15-27-10-12-30-13-11-27/h17-18H,3-15H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | LHWQKASCLAWWMB-MSOLQXFVSA-N |
| XLogP | 4.03 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |