C21H28N4O2S — CID 133322862
ethyl 4-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-2-[(dimethylamino)methyl]-5-methylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 133322862) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is ethyl 4-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-2-[(dimethylamino)methyl]-5-methylthieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 4-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-2-[(dimethylamino)methyl]-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 133322862 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | ethyl 4-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-2-[(dimethylamino)methyl]-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1sc2nc(CN(C)C)nc(N3CC4CC=CCC4C3)c2c1C |
| InChI | InChI=1S/C21H28N4O2S/c1-5-27-21(26)18-13(2)17-19(22-16(12-24(3)4)23-20(17)28-18)25-10-14-8-6-7-9-15(14)11-25/h6-7,14-15H,5,8-12H2,1-4H3 |
| InChIKey | PZXKVOCAEBQDIU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|