About (2S)-3-phenyl-N-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2-(tetrazol-1-yl)propanamide
(2S)-3-phenyl-N-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2-(tetrazol-1-yl)propanamide (PubChem CID 124735606) has the molecular formula C20H21N5O
and a molecular weight of 347.42 g/mol. Its IUPAC name is (2S)-3-phenyl-N-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2-(tetrazol-1-yl)propanamide.
Molecular Properties
| Compound Name | (2S)-3-phenyl-N-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2-(tetrazol-1-yl)propanamide |
| PubChem CID | 124735606 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (2S)-3-phenyl-N-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2-(tetrazol-1-yl)propanamide |
| SMILES | O=C(NC[C@@H]1C[C@H]1c1ccccc1)[C@H](Cc1ccccc1)n1cnnn1 |
| InChI | InChI=1S/C20H21N5O/c26-20(21-13-17-12-18(17)16-9-5-2-6-10-16)19(25-14-22-23-24-25)11-15-7-3-1-4-8-15/h1-10,14,17-19H,11-13H2,(H,21,26)/t17-,18-,19-/m0/s1 |
| InChIKey | NTJSQSSMQGEEKB-FHWLQOOXSA-N |
| XLogP | 2.38 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-3-phenyl-N-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2-(tetrazol-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-phenyl-N-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2-(tetrazol-1-yl)propanamide?
The IUPAC name of (2S)-3-phenyl-N-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2-(tetrazol-1-yl)propanamide (CID 124735606) is (2S)-3-phenyl-N-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2-(tetrazol-1-yl)propanamide.
What is the SMILES notation for (2S)-3-phenyl-N-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2-(tetrazol-1-yl)propanamide?
The canonical SMILES for (2S)-3-phenyl-N-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2-(tetrazol-1-yl)propanamide is O=C(NC[C@@H]1C[C@H]1c1ccccc1)[C@H](Cc1ccccc1)n1cnnn1.
What is the InChIKey of (2S)-3-phenyl-N-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2-(tetrazol-1-yl)propanamide?
The InChIKey is NTJSQSSMQGEEKB-FHWLQOOXSA-N. The full InChI is InChI=1S/C20H21N5O/c26-20(21-13-17-12-18(17)16-9-5-2-6-10-16)19(25-14-22-23-24-25)11-15-7-3-1-4-8-15/h1-10,14,17-19H,11-13H2,(H,21,26)/t17-,18-,19-/m0/s1.
What are the key properties of (2S)-3-phenyl-N-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2-(tetrazol-1-yl)propanamide?
(2S)-3-phenyl-N-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2-(tetrazol-1-yl)propanamide has a molecular weight of 347.42 g/mol, XLogP of 2.38, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-phenyl-N-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2-(tetrazol-1-yl)propanamide is sourced from PubChem (CID 124735606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).