C22H27N3O5S — CID 124737598
4-[(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-N-ethyl-3-nitro-N-phenylbenzenesulfonamide (PubChem CID 124737598) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is 4-[(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-N-ethyl-3-nitro-N-phenylbenzenesulfonamide.
| Compound Name | 4-[(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-N-ethyl-3-nitro-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 124737598 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 4-[(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-N-ethyl-3-nitro-N-phenylbenzenesulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(N2CCO[C@H]3CCCC[C@H]32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H27N3O5S/c1-2-24(17-8-4-3-5-9-17)31(28,29)18-12-13-19(21(16-18)25(26)27)23-14-15-30-22-11-7-6-10-20(22)23/h3-5,8-9,12-13,16,20,22H,2,6-7,10-11,14-15H2,1H3/t20-,22+/m1/s1 |
| InChIKey | PUHYDEUYLPJYDX-IRLDBZIGSA-N |
| XLogP | 3.96 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|