C19H24N4O4S — CID 52501124
N-methyl-4-[(2S)-2-[(N-methylanilino)methyl]pyrrolidin-1-yl]-3-nitrobenzenesulfonamide (PubChem CID 52501124) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-methyl-4-[(2S)-2-[(N-methylanilino)methyl]pyrrolidin-1-yl]-3-nitrobenzenesulfonamide.
| Compound Name | N-methyl-4-[(2S)-2-[(N-methylanilino)methyl]pyrrolidin-1-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 52501124 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-methyl-4-[(2S)-2-[(N-methylanilino)methyl]pyrrolidin-1-yl]-3-nitrobenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N2CCC[C@H]2CN(C)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H24N4O4S/c1-20-28(26,27)17-10-11-18(19(13-17)23(24)25)22-12-6-9-16(22)14-21(2)15-7-4-3-5-8-15/h3-5,7-8,10-11,13,16,20H,6,9,12,14H2,1-2H3/t16-/m0/s1 |
| InChIKey | JADUHOOBBXAVMC-INIZCTEOSA-N |
| XLogP | 2.61 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|