C10H9N3O2 — CID 1247385
5-methyl-N-pyridin-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 1247385) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is 5-methyl-N-pyridin-2-yl-1,2-oxazole-3-carboxamide.
| Compound Name | 5-methyl-N-pyridin-2-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 1247385 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 5-methyl-N-pyridin-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccccn2)no1 |
| InChI | InChI=1S/C10H9N3O2/c1-7-6-8(13-15-7)10(14)12-9-4-2-3-5-11-9/h2-6H,1H3,(H,11,12,14) |
| InChIKey | JCZMIBVIPIVMFK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |