C9H9N5O2 — CID 47414337
5-methyl-N'-pyrimidin-2-yl-1,2-oxazole-3-carbohydrazide (PubChem CID 47414337) has the molecular formula C9H9N5O2 and a molecular weight of 219.20 g/mol. Its IUPAC name is 5-methyl-N'-pyrimidin-2-yl-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-methyl-N'-pyrimidin-2-yl-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 47414337 |
| Molecular Formula | C9H9N5O2 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 5-methyl-N'-pyrimidin-2-yl-1,2-oxazole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNc2ncccn2)no1 |
| InChI | InChI=1S/C9H9N5O2/c1-6-5-7(14-16-6)8(15)12-13-9-10-3-2-4-11-9/h2-5H,1H3,(H,12,15)(H,10,11,13) |
| InChIKey | CAOICRFNDOUELS-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|