About 5-methyl-N-(4-pyrimidin-2-yloxan-4-yl)-1,2-oxazole-3-carboxamide
5-methyl-N-(4-pyrimidin-2-yloxan-4-yl)-1,2-oxazole-3-carboxamide (PubChem CID 138024785) has the molecular formula C14H16N4O3
and a molecular weight of 288.31 g/mol. Its IUPAC name is 5-methyl-N-(4-pyrimidin-2-yloxan-4-yl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-N-(4-pyrimidin-2-yloxan-4-yl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 138024785 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 5-methyl-N-(4-pyrimidin-2-yloxan-4-yl)-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC2(c3ncccn3)CCOCC2)no1 |
| InChI | InChI=1S/C14H16N4O3/c1-10-9-11(18-21-10)12(19)17-14(3-7-20-8-4-14)13-15-5-2-6-16-13/h2,5-6,9H,3-4,7-8H2,1H3,(H,17,19) |
| InChIKey | YCUFCYMSUBLZDD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-methyl-N-(4-pyrimidin-2-yloxan-4-yl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-(4-pyrimidin-2-yloxan-4-yl)-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-methyl-N-(4-pyrimidin-2-yloxan-4-yl)-1,2-oxazole-3-carboxamide (CID 138024785) is 5-methyl-N-(4-pyrimidin-2-yloxan-4-yl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-methyl-N-(4-pyrimidin-2-yloxan-4-yl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-methyl-N-(4-pyrimidin-2-yloxan-4-yl)-1,2-oxazole-3-carboxamide is Cc1cc(C(=O)NC2(c3ncccn3)CCOCC2)no1.
What is the InChIKey of 5-methyl-N-(4-pyrimidin-2-yloxan-4-yl)-1,2-oxazole-3-carboxamide?
The InChIKey is YCUFCYMSUBLZDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O3/c1-10-9-11(18-21-10)12(19)17-14(3-7-20-8-4-14)13-15-5-2-6-16-13/h2,5-6,9H,3-4,7-8H2,1H3,(H,17,19).
What are the key properties of 5-methyl-N-(4-pyrimidin-2-yloxan-4-yl)-1,2-oxazole-3-carboxamide?
5-methyl-N-(4-pyrimidin-2-yloxan-4-yl)-1,2-oxazole-3-carboxamide has a molecular weight of 288.31 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-(4-pyrimidin-2-yloxan-4-yl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 138024785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).