C18H19N3O3 — CID 138024810
N-(4-pyrimidin-2-yloxan-4-yl)-2,3-dihydro-1-benzofuran-5-carboxamide (PubChem CID 138024810) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-(4-pyrimidin-2-yloxan-4-yl)-2,3-dihydro-1-benzofuran-5-carboxamide.
| Compound Name | N-(4-pyrimidin-2-yloxan-4-yl)-2,3-dihydro-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 138024810 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-(4-pyrimidin-2-yloxan-4-yl)-2,3-dihydro-1-benzofuran-5-carboxamide |
| SMILES | O=C(NC1(c2ncccn2)CCOCC1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C18H19N3O3/c22-16(14-2-3-15-13(12-14)4-9-24-15)21-18(5-10-23-11-6-18)17-19-7-1-8-20-17/h1-3,7-8,12H,4-6,9-11H2,(H,21,22) |
| InChIKey | NXBSTTXRRWLBSR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |