C14H13ClFN3O3 — CID 75507636
4-chloro-3-fluoro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]benzamide (PubChem CID 75507636) has the molecular formula C14H13ClFN3O3 and a molecular weight of 325.73 g/mol. Its IUPAC name is 4-chloro-3-fluoro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]benzamide.
| Compound Name | 4-chloro-3-fluoro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]benzamide |
|---|---|
| PubChem CID | 75507636 |
| Molecular Formula | C14H13ClFN3O3 |
| Molecular Weight | 325.73 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 4-chloro-3-fluoro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]benzamide |
| SMILES | O=C(NC1(c2ncon2)CCOCC1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C14H13ClFN3O3/c15-10-2-1-9(7-11(10)16)12(20)18-14(3-5-21-6-4-14)13-17-8-22-19-13/h1-2,7-8H,3-6H2,(H,18,20) |
| InChIKey | RLJJSONPFSMTGU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.73 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |