About 3-chloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]pyridine-4-carboxamide
3-chloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]pyridine-4-carboxamide (PubChem CID 127877610) has the molecular formula C13H13ClN4O3
and a molecular weight of 308.72 g/mol. Its IUPAC name is 3-chloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | 3-chloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]pyridine-4-carboxamide |
| PubChem CID | 127877610 |
| Molecular Formula | C13H13ClN4O3 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 3-chloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]pyridine-4-carboxamide |
| SMILES | O=C(NC1(c2ncon2)CCOCC1)c1ccncc1Cl |
| InChI | InChI=1S/C13H13ClN4O3/c14-10-7-15-4-1-9(10)11(19)17-13(2-5-20-6-3-13)12-16-8-21-18-12/h1,4,7-8H,2-3,5-6H2,(H,17,19) |
| InChIKey | UCGDGNUACZQMDV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-chloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]pyridine-4-carboxamide?
The IUPAC name of 3-chloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]pyridine-4-carboxamide (CID 127877610) is 3-chloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]pyridine-4-carboxamide.
What is the SMILES notation for 3-chloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]pyridine-4-carboxamide?
The canonical SMILES for 3-chloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]pyridine-4-carboxamide is O=C(NC1(c2ncon2)CCOCC1)c1ccncc1Cl.
What is the InChIKey of 3-chloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]pyridine-4-carboxamide?
The InChIKey is UCGDGNUACZQMDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN4O3/c14-10-7-15-4-1-9(10)11(19)17-13(2-5-20-6-3-13)12-16-8-21-18-12/h1,4,7-8H,2-3,5-6H2,(H,17,19).
What are the key properties of 3-chloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]pyridine-4-carboxamide?
3-chloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]pyridine-4-carboxamide has a molecular weight of 308.72 g/mol, XLogP of 1.55, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]pyridine-4-carboxamide is sourced from PubChem (CID 127877610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).