C14H13Cl2N3O3 — CID 75504262
2,5-dichloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]benzamide (PubChem CID 75504262) has the molecular formula C14H13Cl2N3O3 and a molecular weight of 342.18 g/mol. Its IUPAC name is 2,5-dichloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]benzamide.
| Compound Name | 2,5-dichloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]benzamide |
|---|---|
| PubChem CID | 75504262 |
| Molecular Formula | C14H13Cl2N3O3 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 2,5-dichloro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]benzamide |
| SMILES | O=C(NC1(c2ncon2)CCOCC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H13Cl2N3O3/c15-9-1-2-11(16)10(7-9)12(20)18-14(3-5-21-6-4-14)13-17-8-22-19-13/h1-2,7-8H,3-6H2,(H,18,20) |
| InChIKey | JDPXSOBEEKSYST-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |