C20H26N4O3 — CID 124738524
[2-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-(1,2,4-triazol-1-ylmethyl)benzoate (PubChem CID 124738524) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is [2-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-(1,2,4-triazol-1-ylmethyl)benzoate.
| Compound Name | [2-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-(1,2,4-triazol-1-ylmethyl)benzoate |
|---|---|
| PubChem CID | 124738524 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [2-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-(1,2,4-triazol-1-ylmethyl)benzoate |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1NC(=O)COC(=O)c1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C20H26N4O3/c1-14-4-3-5-18(15(14)2)23-19(25)11-27-20(26)17-8-6-16(7-9-17)10-24-13-21-12-22-24/h6-9,12-15,18H,3-5,10-11H2,1-2H3,(H,23,25)/t14-,15+,18-/m1/s1 |
| InChIKey | QZYLHBXMMNHCIS-RVKKMQEKSA-N |
| XLogP | 2.42 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |