C11H14N6O2S — CID 124738907
1-(5-methoxy-1,3,4-thiadiazol-2-yl)-3-[(5R)-4,5,6,7-tetrahydro-1H-indazol-5-yl]urea (PubChem CID 124738907) has the molecular formula C11H14N6O2S and a molecular weight of 294.34 g/mol. Its IUPAC name is 1-(5-methoxy-1,3,4-thiadiazol-2-yl)-3-[(5R)-4,5,6,7-tetrahydro-1H-indazol-5-yl]urea.
| Compound Name | 1-(5-methoxy-1,3,4-thiadiazol-2-yl)-3-[(5R)-4,5,6,7-tetrahydro-1H-indazol-5-yl]urea |
|---|---|
| PubChem CID | 124738907 |
| Molecular Formula | C11H14N6O2S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-(5-methoxy-1,3,4-thiadiazol-2-yl)-3-[(5R)-4,5,6,7-tetrahydro-1H-indazol-5-yl]urea |
| SMILES | COc1nnc(NC(=O)N[C@@H]2CCc3[nH]ncc3C2)s1 |
| InChI | InChI=1S/C11H14N6O2S/c1-19-11-17-16-10(20-11)14-9(18)13-7-2-3-8-6(4-7)5-12-15-8/h5,7H,2-4H2,1H3,(H,12,15)(H2,13,14,16,18)/t7-/m1/s1 |
| InChIKey | RTGPVCCSBUXWBW-SSDOTTSWSA-N |
| XLogP | 0.95 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |