C15H17N5O3 — CID 86804058
1-(2-methyl-4-nitrophenyl)-3-(4,5,6,7-tetrahydro-1H-indazol-5-yl)urea (PubChem CID 86804058) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is 1-(2-methyl-4-nitrophenyl)-3-(4,5,6,7-tetrahydro-1H-indazol-5-yl)urea.
| Compound Name | 1-(2-methyl-4-nitrophenyl)-3-(4,5,6,7-tetrahydro-1H-indazol-5-yl)urea |
|---|---|
| PubChem CID | 86804058 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-(2-methyl-4-nitrophenyl)-3-(4,5,6,7-tetrahydro-1H-indazol-5-yl)urea |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)NC1CCc2[nH]ncc2C1 |
| InChI | InChI=1S/C15H17N5O3/c1-9-6-12(20(22)23)3-5-13(9)18-15(21)17-11-2-4-14-10(7-11)8-16-19-14/h3,5-6,8,11H,2,4,7H2,1H3,(H,16,19)(H2,17,18,21) |
| InChIKey | DTCHVOBFBBNPAS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 112.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|