C13H15N5O2 — CID 122138548
N-(3-methyl-5-nitro-2-pyridinyl)-4,5,6,7-tetrahydro-1H-indazol-6-amine (PubChem CID 122138548) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is N-(3-methyl-5-nitro-2-pyridinyl)-4,5,6,7-tetrahydro-1H-indazol-6-amine.
| Compound Name | N-(3-methyl-5-nitro-2-pyridinyl)-4,5,6,7-tetrahydro-1H-indazol-6-amine |
|---|---|
| PubChem CID | 122138548 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-(3-methyl-5-nitro-2-pyridinyl)-4,5,6,7-tetrahydro-1H-indazol-6-amine |
| SMILES | Cc1cc([N+](=O)[O-])cnc1NC1CCc2cn[nH]c2C1 |
| InChI | InChI=1S/C13H15N5O2/c1-8-4-11(18(19)20)7-14-13(8)16-10-3-2-9-6-15-17-12(9)5-10/h4,6-7,10H,2-3,5H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | IRUPLNOPYMPNBS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|