C12H18N4O2 — CID 55080985
2-N-(3-methyl-5-nitro-2-pyridinyl)cyclohexane-1,2-diamine (PubChem CID 55080985) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-N-(3-methyl-5-nitro-2-pyridinyl)cyclohexane-1,2-diamine.
| Compound Name | 2-N-(3-methyl-5-nitro-2-pyridinyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 55080985 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-N-(3-methyl-5-nitro-2-pyridinyl)cyclohexane-1,2-diamine |
| SMILES | Cc1cc([N+](=O)[O-])cnc1NC1CCCCC1N |
| InChI | InChI=1S/C12H18N4O2/c1-8-6-9(16(17)18)7-14-12(8)15-11-5-3-2-4-10(11)13/h6-7,10-11H,2-5,13H2,1H3,(H,14,15) |
| InChIKey | DPTKXSUXZKPGGF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|