C11H16N4O3 — CID 62475877
N-[(4S)-4-methoxypyrrolidin-3-yl]-3-methyl-5-nitropyridin-2-amine (PubChem CID 62475877) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is N-[(4S)-4-methoxypyrrolidin-3-yl]-3-methyl-5-nitropyridin-2-amine.
| Compound Name | N-[(4S)-4-methoxypyrrolidin-3-yl]-3-methyl-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 62475877 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | N-[(4S)-4-methoxypyrrolidin-3-yl]-3-methyl-5-nitropyridin-2-amine |
| SMILES | CO[C@H]1CNCC1Nc1ncc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C11H16N4O3/c1-7-3-8(15(16)17)4-13-11(7)14-9-5-12-6-10(9)18-2/h3-4,9-10,12H,5-6H2,1-2H3,(H,13,14)/t9?,10-/m0/s1 |
| InChIKey | BLYCAGWBFVLJCD-AXDSSHIGSA-N |
| XLogP | 0.70 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|