C12H13F3N4O3 — CID 95980975
(4R)-4-[(3-methyl-5-nitro-2-pyridinyl)amino]-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one (PubChem CID 95980975) has the molecular formula C12H13F3N4O3 and a molecular weight of 318.26 g/mol. Its IUPAC name is (4R)-4-[(3-methyl-5-nitro-2-pyridinyl)amino]-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one.
| Compound Name | (4R)-4-[(3-methyl-5-nitro-2-pyridinyl)amino]-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 95980975 |
| Molecular Formula | C12H13F3N4O3 |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (4R)-4-[(3-methyl-5-nitro-2-pyridinyl)amino]-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one |
| SMILES | Cc1cc([N+](=O)[O-])cnc1N[C@@H]1CC(=O)N(CC(F)(F)F)C1 |
| InChI | InChI=1S/C12H13F3N4O3/c1-7-2-9(19(21)22)4-16-11(7)17-8-3-10(20)18(5-8)6-12(13,14)15/h2,4,8H,3,5-6H2,1H3,(H,16,17)/t8-/m1/s1 |
| InChIKey | URAZIWDNYHOBNY-MRVPVSSYSA-N |
| XLogP | 1.87 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|