C20H24N2O3 — CID 124740994
(3aS,4R,7S,7aS)-4-methyl-2-phenyl-7-(pyrrolidine-1-carbonyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 124740994) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is (3aS,4R,7S,7aS)-4-methyl-2-phenyl-7-(pyrrolidine-1-carbonyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7S,7aS)-4-methyl-2-phenyl-7-(pyrrolidine-1-carbonyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 124740994 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (3aS,4R,7S,7aS)-4-methyl-2-phenyl-7-(pyrrolidine-1-carbonyl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | C[C@@H]1CC[C@H](C(=O)N2CCCC2)[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C20H24N2O3/c1-13-9-10-15(18(23)21-11-5-6-12-21)17-16(13)19(24)22(20(17)25)14-7-3-2-4-8-14/h2-4,7-8,13,15-17H,5-6,9-12H2,1H3/t13-,15+,16+,17+/m1/s1 |
| InChIKey | VQVIQBLJPXCYFR-IWCQGFGOSA-N |
| XLogP | 2.46 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|