C20H24F3N3O6S — CID 124742233
(2S,3S,4R)-4-methyl-3-(nitromethyl)-2-[2-oxo-2-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethyl]cyclopentan-1-one (PubChem CID 124742233) has the molecular formula C20H24F3N3O6S and a molecular weight of 491.49 g/mol. Its IUPAC name is (2S,3S,4R)-4-methyl-3-(nitromethyl)-2-[2-oxo-2-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethyl]cyclopentan-1-one.
| Compound Name | (2S,3S,4R)-4-methyl-3-(nitromethyl)-2-[2-oxo-2-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 124742233 |
| Molecular Formula | C20H24F3N3O6S |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | (2S,3S,4R)-4-methyl-3-(nitromethyl)-2-[2-oxo-2-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethyl]cyclopentan-1-one |
| SMILES | C[C@@H]1CC(=O)[C@@H](CC(=O)N2CCN(S(=O)(=O)c3ccccc3C(F)(F)F)CC2)[C@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C20H24F3N3O6S/c1-13-10-17(27)14(15(13)12-26(29)30)11-19(28)24-6-8-25(9-7-24)33(31,32)18-5-3-2-4-16(18)20(21,22)23/h2-5,13-15H,6-12H2,1H3/t13-,14+,15+/m1/s1 |
| InChIKey | XGOFFLUEGCVONF-ILXRZTDVSA-N |
| XLogP | 2.05 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|