C16H21FN2O3 — CID 124742939
(1R,5S,6R)-N-[(2-fluoro-6-nitrophenyl)methyl]-N,7,7-trimethyl-2-oxabicyclo[3.2.0]heptan-6-amine (PubChem CID 124742939) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is (1R,5S,6R)-N-[(2-fluoro-6-nitrophenyl)methyl]-N,7,7-trimethyl-2-oxabicyclo[3.2.0]heptan-6-amine.
| Compound Name | (1R,5S,6R)-N-[(2-fluoro-6-nitrophenyl)methyl]-N,7,7-trimethyl-2-oxabicyclo[3.2.0]heptan-6-amine |
|---|---|
| PubChem CID | 124742939 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (1R,5S,6R)-N-[(2-fluoro-6-nitrophenyl)methyl]-N,7,7-trimethyl-2-oxabicyclo[3.2.0]heptan-6-amine |
| SMILES | CN(Cc1c(F)cccc1[N+](=O)[O-])[C@@H]1[C@@H]2CCO[C@H]2C1(C)C |
| InChI | InChI=1S/C16H21FN2O3/c1-16(2)14(10-7-8-22-15(10)16)18(3)9-11-12(17)5-4-6-13(11)19(20)21/h4-6,10,14-15H,7-9H2,1-3H3/t10-,14+,15+/m0/s1 |
| InChIKey | YKIIOOPNJZXZSB-COLVAYQJSA-N |
| XLogP | 2.98 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|