C18H25N3O4 — CID 124866382
N-[(1R,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-N-methyl-2-(N-methyl-2-nitroanilino)acetamide (PubChem CID 124866382) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[(1R,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-N-methyl-2-(N-methyl-2-nitroanilino)acetamide.
| Compound Name | N-[(1R,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-N-methyl-2-(N-methyl-2-nitroanilino)acetamide |
|---|---|
| PubChem CID | 124866382 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-[(1R,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-N-methyl-2-(N-methyl-2-nitroanilino)acetamide |
| SMILES | CN(CC(=O)N(C)[C@@H]1[C@@H]2CCO[C@H]2C1(C)C)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H25N3O4/c1-18(2)16(12-9-10-25-17(12)18)20(4)15(22)11-19(3)13-7-5-6-8-14(13)21(23)24/h5-8,12,16-17H,9-11H2,1-4H3/t12-,16+,17+/m0/s1 |
| InChIKey | UFUPENVUFDEGIC-JCURWCKSSA-N |
| XLogP | 2.30 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|