C23H26ClN3O4S — CID 124744797
(1R,9S,13S)-N-(4-chlorophenyl)-6-methoxy-10-(3-methoxypropyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 124744797) has the molecular formula C23H26ClN3O4S and a molecular weight of 476.00 g/mol. Its IUPAC name is (1R,9S,13S)-N-(4-chlorophenyl)-6-methoxy-10-(3-methoxypropyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | (1R,9S,13S)-N-(4-chlorophenyl)-6-methoxy-10-(3-methoxypropyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 124744797 |
| Molecular Formula | C23H26ClN3O4S |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | (1R,9S,13S)-N-(4-chlorophenyl)-6-methoxy-10-(3-methoxypropyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | COCCCN1C(=S)N[C@H]2c3cccc(OC)c3O[C@@]1(C)[C@H]2C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H26ClN3O4S/c1-23-18(21(28)25-15-10-8-14(24)9-11-15)19(26-22(32)27(23)12-5-13-29-2)16-6-4-7-17(30-3)20(16)31-23/h4,6-11,18-19H,5,12-13H2,1-3H3,(H,25,28)(H,26,32)/t18-,19+,23+/m1/s1 |
| InChIKey | BOMHRDUZHXZFHP-MSYCTHLASA-N |
| XLogP | 3.98 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|