C27H26ClN3O4S — CID 98045743
(1R,9S,13R)-N-(4-chlorophenyl)-10-(4-ethoxyphenyl)-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 98045743) has the molecular formula C27H26ClN3O4S and a molecular weight of 524.04 g/mol. Its IUPAC name is (1R,9S,13R)-N-(4-chlorophenyl)-10-(4-ethoxyphenyl)-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | (1R,9S,13R)-N-(4-chlorophenyl)-10-(4-ethoxyphenyl)-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 98045743 |
| Molecular Formula | C27H26ClN3O4S |
| Molecular Weight | 524.04 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | (1R,9S,13R)-N-(4-chlorophenyl)-10-(4-ethoxyphenyl)-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | CCOc1ccc(N2C(=S)N[C@H]3c4cccc(OC)c4O[C@@]2(C)[C@@H]3C(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H26ClN3O4S/c1-4-34-19-14-12-18(13-15-19)31-26(36)30-23-20-6-5-7-21(33-3)24(20)35-27(31,2)22(23)25(32)29-17-10-8-16(28)9-11-17/h5-15,22-23H,4H2,1-3H3,(H,29,32)(H,30,36)/t22-,23-,27-/m0/s1 |
| InChIKey | SERBJLYCVOYBIY-WCYRKSIYSA-N |
| XLogP | 5.55 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.04 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|