C26H23BrClN3O3S — CID 98045326
(1S,9S,13S)-10-(3-bromophenyl)-N-(4-chlorophenyl)-6-ethoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 98045326) has the molecular formula C26H23BrClN3O3S and a molecular weight of 572.91 g/mol. Its IUPAC name is (1S,9S,13S)-10-(3-bromophenyl)-N-(4-chlorophenyl)-6-ethoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | (1S,9S,13S)-10-(3-bromophenyl)-N-(4-chlorophenyl)-6-ethoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 98045326 |
| Molecular Formula | C26H23BrClN3O3S |
| Molecular Weight | 572.91 g/mol |
| Exact Mass | 571.03 |
| IUPAC Name | (1S,9S,13S)-10-(3-bromophenyl)-N-(4-chlorophenyl)-6-ethoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | CCOc1cccc2c1O[C@@]1(C)[C@@H](C(=O)Nc3ccc(Cl)cc3)[C@@H]2NC(=S)N1c1cccc(Br)c1 |
| InChI | InChI=1S/C26H23BrClN3O3S/c1-3-33-20-9-5-8-19-22-21(24(32)29-17-12-10-16(28)11-13-17)26(2,34-23(19)20)31(25(35)30-22)18-7-4-6-15(27)14-18/h4-14,21-22H,3H2,1-2H3,(H,29,32)(H,30,35)/t21-,22-,26+/m1/s1 |
| InChIKey | YFYXJTXZKPJSCL-DRLORSAXSA-N |
| XLogP | 6.30 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.91 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|