C16H18FN3 — CID 124746275
4-(3-fluorophenyl)-6-methyl-2-[(3S)-piperidin-3-yl]pyrimidine (PubChem CID 124746275) has the molecular formula C16H18FN3 and a molecular weight of 271.34 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-6-methyl-2-[(3S)-piperidin-3-yl]pyrimidine.
| Compound Name | 4-(3-fluorophenyl)-6-methyl-2-[(3S)-piperidin-3-yl]pyrimidine |
|---|---|
| PubChem CID | 124746275 |
| Molecular Formula | C16H18FN3 |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 4-(3-fluorophenyl)-6-methyl-2-[(3S)-piperidin-3-yl]pyrimidine |
| SMILES | Cc1cc(-c2cccc(F)c2)nc([C@H]2CCCNC2)n1 |
| InChI | InChI=1S/C16H18FN3/c1-11-8-15(12-4-2-6-14(17)9-12)20-16(19-11)13-5-3-7-18-10-13/h2,4,6,8-9,13,18H,3,5,7,10H2,1H3/t13-/m0/s1 |
| InChIKey | KXJVFBQDDGBNEW-ZDUSSCGKSA-N |
| XLogP | 3.06 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |