C11H19Cl2N3 — CID 71299007
4,6-dimethyl-2-piperidin-3-ylpyrimidine;dihydrochloride (PubChem CID 71299007) has the molecular formula C11H19Cl2N3 and a molecular weight of 264.20 g/mol. Its IUPAC name is 4,6-dimethyl-2-piperidin-3-ylpyrimidine;dihydrochloride.
| Compound Name | 4,6-dimethyl-2-piperidin-3-ylpyrimidine;dihydrochloride |
|---|---|
| PubChem CID | 71299007 |
| Molecular Formula | C11H19Cl2N3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 4,6-dimethyl-2-piperidin-3-ylpyrimidine;dihydrochloride |
| SMILES | Cc1cc(C)nc(C2CCCNC2)n1.Cl.Cl |
| InChI | InChI=1S/C11H17N3.2ClH/c1-8-6-9(2)14-11(13-8)10-4-3-5-12-7-10;;/h6,10,12H,3-5,7H2,1-2H3;2*1H |
| InChIKey | CMOJIFDUANFALF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |