C17H23NO3 — CID 124746446
tert-butyl (1S,4R,6S)-4-methyl-6-phenyl-7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 124746446) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is tert-butyl (1S,4R,6S)-4-methyl-6-phenyl-7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | tert-butyl (1S,4R,6S)-4-methyl-6-phenyl-7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 124746446 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | tert-butyl (1S,4R,6S)-4-methyl-6-phenyl-7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | C[C@@H]1C[C@@]2(c3ccccc3)O[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23NO3/c1-12-10-17(13-8-6-5-7-9-13)14(20-17)11-18(12)15(19)21-16(2,3)4/h5-9,12,14H,10-11H2,1-4H3/t12-,14+,17+/m1/s1 |
| InChIKey | LMBWIHZYLUOZSK-IFIJOSMWSA-N |
| XLogP | 3.31 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|