C15H20N2O3 — CID 124848069
tert-butyl (1R,6R)-6-pyridin-3-yl-7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 124848069) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is tert-butyl (1R,6R)-6-pyridin-3-yl-7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | tert-butyl (1R,6R)-6-pyridin-3-yl-7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 124848069 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | tert-butyl (1R,6R)-6-pyridin-3-yl-7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@]2(c3cccnc3)O[C@@H]2C1 |
| InChI | InChI=1S/C15H20N2O3/c1-14(2,3)20-13(18)17-8-6-15(12(10-17)19-15)11-5-4-7-16-9-11/h4-5,7,9,12H,6,8,10H2,1-3H3/t12-,15-/m1/s1 |
| InChIKey | MBWGSEWCBMBZNO-IUODEOHRSA-N |
| XLogP | 2.32 |
| TPSA | 54.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|