About N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[(2R)-2-(3-methoxyphenyl)azetidin-1-yl]acetamide
N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[(2R)-2-(3-methoxyphenyl)azetidin-1-yl]acetamide (PubChem CID 124749387) has the molecular formula C19H25N3O2S
and a molecular weight of 359.50 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[(2R)-2-(3-methoxyphenyl)azetidin-1-yl]acetamide.
Molecular Properties
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[(2R)-2-(3-methoxyphenyl)azetidin-1-yl]acetamide |
| PubChem CID | 124749387 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[(2R)-2-(3-methoxyphenyl)azetidin-1-yl]acetamide |
| SMILES | COc1cccc([C@H]2CCN2CC(=O)Nc2nc(C(C)(C)C)cs2)c1 |
| InChI | InChI=1S/C19H25N3O2S/c1-19(2,3)16-12-25-18(20-16)21-17(23)11-22-9-8-15(22)13-6-5-7-14(10-13)24-4/h5-7,10,12,15H,8-9,11H2,1-4H3,(H,20,21,23)/t15-/m1/s1 |
| InChIKey | AMCWCXNWFAIDJM-OAHLLOKOSA-N |
| XLogP | 3.83 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[(2R)-2-(3-methoxyphenyl)azetidin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[(2R)-2-(3-methoxyphenyl)azetidin-1-yl]acetamide?
The IUPAC name of N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[(2R)-2-(3-methoxyphenyl)azetidin-1-yl]acetamide (CID 124749387) is N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[(2R)-2-(3-methoxyphenyl)azetidin-1-yl]acetamide.
What is the SMILES notation for N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[(2R)-2-(3-methoxyphenyl)azetidin-1-yl]acetamide?
The canonical SMILES for N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[(2R)-2-(3-methoxyphenyl)azetidin-1-yl]acetamide is COc1cccc([C@H]2CCN2CC(=O)Nc2nc(C(C)(C)C)cs2)c1.
What is the InChIKey of N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[(2R)-2-(3-methoxyphenyl)azetidin-1-yl]acetamide?
The InChIKey is AMCWCXNWFAIDJM-OAHLLOKOSA-N. The full InChI is InChI=1S/C19H25N3O2S/c1-19(2,3)16-12-25-18(20-16)21-17(23)11-22-9-8-15(22)13-6-5-7-14(10-13)24-4/h5-7,10,12,15H,8-9,11H2,1-4H3,(H,20,21,23)/t15-/m1/s1.
What are the key properties of N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[(2R)-2-(3-methoxyphenyl)azetidin-1-yl]acetamide?
N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[(2R)-2-(3-methoxyphenyl)azetidin-1-yl]acetamide has a molecular weight of 359.50 g/mol, XLogP of 3.83, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[(2R)-2-(3-methoxyphenyl)azetidin-1-yl]acetamide is sourced from PubChem (CID 124749387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).