C18H21N3O2S — CID 78872729
N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(5-methoxy-1H-indol-3-yl)acetamide (PubChem CID 78872729) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(5-methoxy-1H-indol-3-yl)acetamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(5-methoxy-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 78872729 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(5-methoxy-1H-indol-3-yl)acetamide |
| SMILES | COc1ccc2[nH]cc(CC(=O)Nc3nc(C(C)(C)C)cs3)c2c1 |
| InChI | InChI=1S/C18H21N3O2S/c1-18(2,3)15-10-24-17(20-15)21-16(22)7-11-9-19-14-6-5-12(23-4)8-13(11)14/h5-6,8-10,19H,7H2,1-4H3,(H,20,21,22) |
| InChIKey | LSEIQUTWCQQXOP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |