C15H17FN2O2S — CID 32995528
N-(4-tert-butyl-1,3-thiazol-2-yl)-2-fluoro-4-methoxybenzamide (PubChem CID 32995528) has the molecular formula C15H17FN2O2S and a molecular weight of 308.38 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-2-fluoro-4-methoxybenzamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-fluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 32995528 |
| Molecular Formula | C15H17FN2O2S |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-fluoro-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2nc(C(C)(C)C)cs2)c(F)c1 |
| InChI | InChI=1S/C15H17FN2O2S/c1-15(2,3)12-8-21-14(17-12)18-13(19)10-6-5-9(20-4)7-11(10)16/h5-8H,1-4H3,(H,17,18,19) |
| InChIKey | ZUPMBRSGBUWMQZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |