C15H15N3O2S — CID 154833363
2-(5-methoxy-1H-indol-3-yl)-N-(2-methyl-1,3-thiazol-5-yl)acetamide (PubChem CID 154833363) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-(5-methoxy-1H-indol-3-yl)-N-(2-methyl-1,3-thiazol-5-yl)acetamide.
| Compound Name | 2-(5-methoxy-1H-indol-3-yl)-N-(2-methyl-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 154833363 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-(5-methoxy-1H-indol-3-yl)-N-(2-methyl-1,3-thiazol-5-yl)acetamide |
| SMILES | COc1ccc2[nH]cc(CC(=O)Nc3cnc(C)s3)c2c1 |
| InChI | InChI=1S/C15H15N3O2S/c1-9-16-8-15(21-9)18-14(19)5-10-7-17-13-4-3-11(20-2)6-12(10)13/h3-4,6-8,17H,5H2,1-2H3,(H,18,19) |
| InChIKey | MFFIIEQNJGKIPY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |