C18H23N5O2 — CID 124750646
2-[(2S)-1-[(3-benzylimidazol-4-yl)methyl]-3-oxopiperazin-2-yl]-N-methylacetamide (PubChem CID 124750646) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 2-[(2S)-1-[(3-benzylimidazol-4-yl)methyl]-3-oxopiperazin-2-yl]-N-methylacetamide.
| Compound Name | 2-[(2S)-1-[(3-benzylimidazol-4-yl)methyl]-3-oxopiperazin-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 124750646 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-[(2S)-1-[(3-benzylimidazol-4-yl)methyl]-3-oxopiperazin-2-yl]-N-methylacetamide |
| SMILES | CNC(=O)C[C@H]1C(=O)NCCN1Cc1cncn1Cc1ccccc1 |
| InChI | InChI=1S/C18H23N5O2/c1-19-17(24)9-16-18(25)21-7-8-22(16)12-15-10-20-13-23(15)11-14-5-3-2-4-6-14/h2-6,10,13,16H,7-9,11-12H2,1H3,(H,19,24)(H,21,25)/t16-/m0/s1 |
| InChIKey | DOBFGHXAOQMFMK-INIZCTEOSA-N |
| XLogP | 0.37 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |