C18H21N3O2 — CID 124751059
(3R)-1-[(2-ethylpyrimidin-5-yl)methyl]-3-phenylpyrrolidine-3-carboxylic acid (PubChem CID 124751059) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is (3R)-1-[(2-ethylpyrimidin-5-yl)methyl]-3-phenylpyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-1-[(2-ethylpyrimidin-5-yl)methyl]-3-phenylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 124751059 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (3R)-1-[(2-ethylpyrimidin-5-yl)methyl]-3-phenylpyrrolidine-3-carboxylic acid |
| SMILES | CCc1ncc(CN2CC[C@@](C(=O)O)(c3ccccc3)C2)cn1 |
| InChI | InChI=1S/C18H21N3O2/c1-2-16-19-10-14(11-20-16)12-21-9-8-18(13-21,17(22)23)15-6-4-3-5-7-15/h3-7,10-11H,2,8-9,12-13H2,1H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | FSICRSRNWWQVHP-SFHVURJKSA-N |
| XLogP | 2.27 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |