C20H25N3O4 — CID 70776089
1-[(2-ethylpyrimidin-5-yl)methyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid (PubChem CID 70776089) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-[(2-ethylpyrimidin-5-yl)methyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid.
| Compound Name | 1-[(2-ethylpyrimidin-5-yl)methyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 70776089 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-[(2-ethylpyrimidin-5-yl)methyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid |
| SMILES | CCc1ncc(CN2CCC(Oc3ccccc3OC)(C(=O)O)CC2)cn1 |
| InChI | InChI=1S/C20H25N3O4/c1-3-18-21-12-15(13-22-18)14-23-10-8-20(9-11-23,19(24)25)27-17-7-5-4-6-16(17)26-2/h4-7,12-13H,3,8-11,14H2,1-2H3,(H,24,25) |
| InChIKey | LJYTYOZGFZEEDE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |