About 1-[(2R)-2,3-dihydroxypropyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid
1-[(2R)-2,3-dihydroxypropyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid (PubChem CID 96576694) has the molecular formula C16H23NO6
and a molecular weight of 325.36 g/mol. Its IUPAC name is 1-[(2R)-2,3-dihydroxypropyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(2R)-2,3-dihydroxypropyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid |
| PubChem CID | 96576694 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1-[(2R)-2,3-dihydroxypropyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid |
| SMILES | COc1ccccc1OC1(C(=O)O)CCN(C[C@@H](O)CO)CC1 |
| InChI | InChI=1S/C16H23NO6/c1-22-13-4-2-3-5-14(13)23-16(15(20)21)6-8-17(9-7-16)10-12(19)11-18/h2-5,12,18-19H,6-11H2,1H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | HFYNSHBRFSTEPE-GFCCVEGCSA-N |
| XLogP | 0.35 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(2R)-2,3-dihydroxypropyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-2,3-dihydroxypropyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid?
The IUPAC name of 1-[(2R)-2,3-dihydroxypropyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid (CID 96576694) is 1-[(2R)-2,3-dihydroxypropyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid.
What is the SMILES notation for 1-[(2R)-2,3-dihydroxypropyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid?
The canonical SMILES for 1-[(2R)-2,3-dihydroxypropyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid is COc1ccccc1OC1(C(=O)O)CCN(C[C@@H](O)CO)CC1.
What is the InChIKey of 1-[(2R)-2,3-dihydroxypropyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid?
The InChIKey is HFYNSHBRFSTEPE-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H23NO6/c1-22-13-4-2-3-5-14(13)23-16(15(20)21)6-8-17(9-7-16)10-12(19)11-18/h2-5,12,18-19H,6-11H2,1H3,(H,20,21)/t12-/m1/s1.
What are the key properties of 1-[(2R)-2,3-dihydroxypropyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid?
1-[(2R)-2,3-dihydroxypropyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid has a molecular weight of 325.36 g/mol, XLogP of 0.35, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-2,3-dihydroxypropyl]-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid is sourced from PubChem (CID 96576694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).