C19H21N3O5 — CID 70755771
1-(3-carbamoyl-2-pyridinyl)-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid (PubChem CID 70755771) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 1-(3-carbamoyl-2-pyridinyl)-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid.
| Compound Name | 1-(3-carbamoyl-2-pyridinyl)-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 70755771 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-(3-carbamoyl-2-pyridinyl)-4-(2-methoxyphenoxy)piperidine-4-carboxylic acid |
| SMILES | COc1ccccc1OC1(C(=O)O)CCN(c2ncccc2C(N)=O)CC1 |
| InChI | InChI=1S/C19H21N3O5/c1-26-14-6-2-3-7-15(14)27-19(18(24)25)8-11-22(12-9-19)17-13(16(20)23)5-4-10-21-17/h2-7,10H,8-9,11-12H2,1H3,(H2,20,23)(H,24,25) |
| InChIKey | DBHDZNKTIQSYBU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |