C18H20FNO5 — CID 56882724
4-(2-fluorophenoxy)-1-[[5-(hydroxymethyl)furan-2-yl]methyl]piperidine-4-carboxylic acid (PubChem CID 56882724) has the molecular formula C18H20FNO5 and a molecular weight of 349.36 g/mol. Its IUPAC name is 4-(2-fluorophenoxy)-1-[[5-(hydroxymethyl)furan-2-yl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 4-(2-fluorophenoxy)-1-[[5-(hydroxymethyl)furan-2-yl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 56882724 |
| Molecular Formula | C18H20FNO5 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 4-(2-fluorophenoxy)-1-[[5-(hydroxymethyl)furan-2-yl]methyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(Oc2ccccc2F)CCN(Cc2ccc(CO)o2)CC1 |
| InChI | InChI=1S/C18H20FNO5/c19-15-3-1-2-4-16(15)25-18(17(22)23)7-9-20(10-8-18)11-13-5-6-14(12-21)24-13/h1-6,21H,7-12H2,(H,22,23) |
| InChIKey | QEYRATKIORBANG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |