C17H16FNO5 — CID 56883286
4-(2-fluorophenoxy)-1-(furan-3-carbonyl)piperidine-4-carboxylic acid (PubChem CID 56883286) has the molecular formula C17H16FNO5 and a molecular weight of 333.31 g/mol. Its IUPAC name is 4-(2-fluorophenoxy)-1-(furan-3-carbonyl)piperidine-4-carboxylic acid.
| Compound Name | 4-(2-fluorophenoxy)-1-(furan-3-carbonyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 56883286 |
| Molecular Formula | C17H16FNO5 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 4-(2-fluorophenoxy)-1-(furan-3-carbonyl)piperidine-4-carboxylic acid |
| SMILES | O=C(c1ccoc1)N1CCC(Oc2ccccc2F)(C(=O)O)CC1 |
| InChI | InChI=1S/C17H16FNO5/c18-13-3-1-2-4-14(13)24-17(16(21)22)6-8-19(9-7-17)15(20)12-5-10-23-11-12/h1-5,10-11H,6-9H2,(H,21,22) |
| InChIKey | KCFLCYVKGMFRMJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |