About (3R)-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-morpholin-4-ylbutan-1-one
(3R)-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-morpholin-4-ylbutan-1-one (PubChem CID 124751741) has the molecular formula C18H29N5O2
and a molecular weight of 347.46 g/mol. Its IUPAC name is (3R)-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-morpholin-4-ylbutan-1-one.
Molecular Properties
| Compound Name | (3R)-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-morpholin-4-ylbutan-1-one |
| PubChem CID | 124751741 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | (3R)-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-morpholin-4-ylbutan-1-one |
| SMILES | Cc1ncnc(N2CCN(C(=O)C[C@@H](C)N3CCOCC3)CC2)c1C |
| InChI | InChI=1S/C18H29N5O2/c1-14(21-8-10-25-11-9-21)12-17(24)22-4-6-23(7-5-22)18-15(2)16(3)19-13-20-18/h13-14H,4-12H2,1-3H3/t14-/m1/s1 |
| InChIKey | HJFJSQBEHDCKHC-CQSZACIVSA-N |
| XLogP | 0.85 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3R)-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-morpholin-4-ylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-morpholin-4-ylbutan-1-one?
The IUPAC name of (3R)-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-morpholin-4-ylbutan-1-one (CID 124751741) is (3R)-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-morpholin-4-ylbutan-1-one.
What is the SMILES notation for (3R)-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-morpholin-4-ylbutan-1-one?
The canonical SMILES for (3R)-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-morpholin-4-ylbutan-1-one is Cc1ncnc(N2CCN(C(=O)C[C@@H](C)N3CCOCC3)CC2)c1C.
What is the InChIKey of (3R)-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-morpholin-4-ylbutan-1-one?
The InChIKey is HJFJSQBEHDCKHC-CQSZACIVSA-N. The full InChI is InChI=1S/C18H29N5O2/c1-14(21-8-10-25-11-9-21)12-17(24)22-4-6-23(7-5-22)18-15(2)16(3)19-13-20-18/h13-14H,4-12H2,1-3H3/t14-/m1/s1.
What are the key properties of (3R)-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-morpholin-4-ylbutan-1-one?
(3R)-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-morpholin-4-ylbutan-1-one has a molecular weight of 347.46 g/mol, XLogP of 0.85, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-3-morpholin-4-ylbutan-1-one is sourced from PubChem (CID 124751741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).