C22H28N4O — CID 124755369
[(2R)-1-benzylpiperidin-2-yl]-(4-pyrimidin-4-ylpiperidin-1-yl)methanone (PubChem CID 124755369) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is [(2R)-1-benzylpiperidin-2-yl]-(4-pyrimidin-4-ylpiperidin-1-yl)methanone.
| Compound Name | [(2R)-1-benzylpiperidin-2-yl]-(4-pyrimidin-4-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 124755369 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | [(2R)-1-benzylpiperidin-2-yl]-(4-pyrimidin-4-ylpiperidin-1-yl)methanone |
| SMILES | O=C([C@H]1CCCCN1Cc1ccccc1)N1CCC(c2ccncn2)CC1 |
| InChI | InChI=1S/C22H28N4O/c27-22(25-14-10-19(11-15-25)20-9-12-23-17-24-20)21-8-4-5-13-26(21)16-18-6-2-1-3-7-18/h1-3,6-7,9,12,17,19,21H,4-5,8,10-11,13-16H2/t21-/m1/s1 |
| InChIKey | QFBCBXHYSXXOLB-OAQYLSRUSA-N |
| XLogP | 3.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |